Compound Q&A

What are the physical and chemical properties of 3,6-Di(4-biphenylyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione (CAS: 88949-33-1)?

Answer

3,6-Di(4-biphenylyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione
The compound 3,6-Di(4-biphenylyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione has a crystalline form with a molecular weight of approximately 678.38 g/mol. It has a low solubility in water but is soluble in organic solvents like dichloromethane and tetrahydrofuran. The compound is known for its high reactivity, particularly in photochemical reactions and its ability to form stable complexes with metal ions.

About

CAS No 88949-33-1
English Name 3,6-Di(4-biphenylyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione
Molecular Formula C30H20N2O2
Molecular Weight 440.5 g/mol
SMILES c1ccc(cc1)c2ccc(cc2)C3=C4C(=C(NC4=O)c5ccc(cc5)c6ccccc6)C(=O)N3
InChIKey YLGDYASRRVBIRS-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 3,6-Di(4-biphenylyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione (CAS: 88949-33-1) typically synthesized?

3,6-Di(4-biphenylyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione is usually synthesized via a multist...

Compound Q&A

What industries use 3,6-Di(4-biphenylyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione (CAS: 88949-33-1)?

3,6-Di(4-biphenylyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione finds applications in several indust...

Compound Q&A

What precautions should be taken when handling 3,6-Di(4-biphenylyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione (CAS: 88949-33-1)?

When handling 3,6-Di(4-biphenylyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione, it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...