Compound Q&A

What industries use 4-Methoxycinnamic Acid Ethyl Ester (CAS: 1929-30-2)?

Answer

4-Methoxycinnamic Acid Ethyl Ester
4-Methoxycinnamic Acid Ethyl Ester (CAS: 1929-30-2) finds applications in various industries. It is used in the pharmaceutical industry for the synthesis of certain drug intermediates. In the polymer industry, it serves as a monomer or precursor for the production of polymers with specific properties. Additionally, it is utilized in the sensor and semiconductor industries for the development of sensitive chemical sensors and in electronic applications due to its stability and reactivity.

About

CAS No 1929-30-2
English Name 4-Methoxycinnamic Acid Ethyl Ester
Molecular Formula C12H14O3
Molecular Weight 206.24 g/mol
SMILES CCOC(=O)C=CC1=CC=C(C=C1)OC
InChIKey DHNGCHLFKUPGPX-RMKNXTFCSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methoxycinnamic Acid Ethyl Ester (CAS: 1929-30-2)?

4-Methoxycinnamic Acid Ethyl Ester (CAS: 1929-30-2) is a white crystalline solid with a molecular we...

Compound Q&A

How is 4-Methoxycinnamic Acid Ethyl Ester (CAS: 1929-30-2) typically synthesized?

4-Methoxycinnamic Acid Ethyl Ester (CAS: 1929-30-2) is typically synthesized via esterification of 4...

Compound Q&A

What precautions should be taken when handling 4-Methoxycinnamic Acid Ethyl Ester (CAS: 1929-30-2)?

When handling 4-Methoxycinnamic Acid Ethyl Ester (CAS: 1929-30-2), appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...