Compound Q&A

What precautions should be taken when handling 4-Chloro-2-fluorobenzotrifluoride (CAS: 94444-59-4)?

Answer

4-Chloro-2-fluorobenzotrifluoride
Handling 4-Chloro-2-fluorobenzotrifluoride requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The material should be stored in a tightly sealed container in a cool, well-ventilated area away from heat and ignition sources. In case of spill, the spill should be handled using appropriate safety measures and the material safety data sheet (MSDS) should be consulted.

About

CAS No 94444-59-4
English Name 4-Chloro-2-fluorobenzotrifluoride
Molecular Formula C7H3ClF4
Molecular Weight 198.55 g/mol
SMILES C1=CC(=C(C=C1Cl)F)C(F)(F)F
InChIKey VRVYSPQZUGVNKJ-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-2-fluorobenzotrifluoride (CAS: 94444-59-4)?

4-Chloro-2-fluorobenzotrifluoride is a crystalline solid with a molecular weight of 263.02 g/mol. It...

Compound Q&A

How is 4-Chloro-2-fluorobenzotrifluoride (CAS: 94444-59-4) typically synthesized?

4-Chloro-2-fluorobenzotrifluoride is typically synthesized through the electrophilic fluorination of...

Compound Q&A

What industries use 4-Chloro-2-fluorobenzotrifluoride (CAS: 94444-59-4)?

4-Chloro-2-fluorobenzotrifluoride is used in the pharmaceutical industry for the synthesis of organi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...