Compound Q&A

What industries use (S)-tert-butyl 2-methylpiperazine-1-carboxylate hydrochloride (CAS: 960283-58-3)?

Answer

(S)-tert-butyl 2-methylpiperazine-1-carboxylate hydrochloride
(S)-tert-butyl 2-methylpiperazine-1-carboxylate hydrochloride (CAS: 960283-58-3) is used in the pharmaceutical, agricultural, and cosmetic industries. It serves as a precursor for the synthesis of various drugs and agrochemicals. Additionally, it can be utilized as a modifier in the production of polymers and as a component in sensor technologies due to its solubility and reactivity properties.

About

English Name (S)-tert-butyl 2-methylpiperazine-1-carboxylate hydrochloride
Molecular Formula C10H21ClN2O2
Molecular Weight 236.74 g/mol
SMILES CC1CNCCN1C(=O)OC(C)(C)C.Cl
InChIKey CAKKNXNGNSFBHG-QRPNPIFTSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-tert-butyl 2-methylpiperazine-1-carboxylate hydrochloride (CAS: 960283-58-3)?

(S)-tert-butyl 2-methylpiperazine-1-carboxylate hydrochloride (CAS: 960283-58-3) is a crystalline so...

Compound Q&A

How is (S)-tert-butyl 2-methylpiperazine-1-carboxylate hydrochloride (CAS: 960283-58-3) typically synthesized?

(S)-tert-butyl 2-methylpiperazine-1-carboxylate hydrochloride (CAS: 960283-58-3) is synthesized via ...

Compound Q&A

What precautions should be taken when handling (S)-tert-butyl 2-methylpiperazine-1-carboxylate hydrochloride (CAS: 960283-58-3)?

When handling (S)-tert-butyl 2-methylpiperazine-1-carboxylate hydrochloride (CAS: 960283-58-3), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...