Compound Q&A

What industries use tert-Butyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate (CAS: 325486-45-1)?

Answer

tert-Butyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate
tert-Butyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate has applications in the pharmaceutical industry, where it can serve as an intermediate in the synthesis of medicinal compounds. It is also utilized in the polymer industry for its ability to improve the properties of polymers. Additionally, it finds use in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name tert-Butyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate
Molecular Formula C10H15NO3
Molecular Weight 197.23 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(=O)C=C1
InChIKey HUBLTIMZFCYNES-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate (CAS: 325486-45-1)?

tert-Butyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate is a white crystalline solid with a molecula...

Compound Q&A

How is tert-Butyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate (CAS: 325486-45-1) typically synthesized?

tert-Butyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate is often synthesized via a multistep process...

Compound Q&A

What precautions should be taken when handling tert-Butyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate (CAS: 325486-45-1)?

When handling tert-Butyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate, it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...