Compound Q&A

What industries use 1,5-Dichloro-2-isopropoxy-4-nitrobenzene (CAS: 41200-97-9)?

Answer

1,5-Dichloro-2-isopropoxy-4-nitrobenzene
1,5-Dichloro-2-isopropoxy-4-nitrobenzene is used in the pharmaceutical industry as an intermediate for synthesizing various drugs. It also finds applications in the polymer industry for developing new materials and in the sensor industry for detecting specific chemical species. Additionally, it plays a role in the semiconductor industry for certain manufacturing processes.

About

CAS No 41200-97-9
English Name 1,5-Dichloro-2-isopropoxy-4-nitrobenzene
Molecular Formula C9H9Cl2NO3
Molecular Weight 250.08 g/mol
SMILES CC(C)OC1=C(C=C(C(=C1)[N+](=O)[O-])Cl)Cl
InChIKey USZMRJRYGHZJID-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,5-Dichloro-2-isopropoxy-4-nitrobenzene (CAS: 41200-97-9)?

1,5-Dichloro-2-isopropoxy-4-nitrobenzene is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 1,5-Dichloro-2-isopropoxy-4-nitrobenzene (CAS: 41200-97-9) typically synthesized?

1,5-Dichloro-2-isopropoxy-4-nitrobenzene is synthesized via a multi-step process starting with nitro...

Compound Q&A

What precautions should be taken when handling 1,5-Dichloro-2-isopropoxy-4-nitrobenzene (CAS: 41200-97-9)?

When handling 1,5-Dichloro-2-isopropoxy-4-nitrobenzene, ensure proper personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...