Compound Q&A

What precautions should be taken when handling 3'-Methoxy-4-biphenylamine (CAS: 207287-79-4)?

Answer

3'-Methoxy-4-biphenylamine
When handling 3'-Methoxy-4-biphenylamine (CAS: 207287-79-4), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize inhalation risks. Spills should be handled using appropriate absorbent materials, and the area should be thoroughly cleaned. Refer to the Safety Data Sheet (SDS) for detailed emergency procedures and storage requirements.

About

English Name 3'-Methoxy-4-biphenylamine
Molecular Formula C13H13NO
Molecular Weight 199.25 g/mol
SMILES COC1=CC=CC(=C1)C2=CC=C(C=C2)N
InChIKey OSWFIVFLDKOXQC-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3'-Methoxy-4-biphenylamine (CAS: 207287-79-4)?

3'-Methoxy-4-biphenylamine (CAS: 207287-79-4) is a crystalline solid with a molecular weight of appr...

Compound Q&A

How is 3'-Methoxy-4-biphenylamine (CAS: 207287-79-4) typically synthesized?

3'-Methoxy-4-biphenylamine can be synthesized through the coupling of 4-bromobiphenyl and methanol u...

Compound Q&A

What industries use 3'-Methoxy-4-biphenylamine (CAS: 207287-79-4)?

3'-Methoxy-4-biphenylamine (CAS: 207287-79-4) is primarily used in the pharmaceutical and sensor ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...