Compound Q&A

How is 2-(Benzoyloxy)-2-methylpropanoic acid (CAS: 58570-00-6) typically synthesized?

Answer

2-(Benzoyloxy)-2-methylpropanoic acid
2-(Benzoyloxy)-2-methylpropanoic acid can be synthesized via a multi-step process starting from benzyl chloride and methanol. Key steps include the formation of a benzoyl chloride intermediate, followed by the addition of methanol and subsequent acid catalyzed hydrolysis. The reaction conditions and catalysts used can influence the yield and selectivity of the product.

About

CAS No 58570-00-6
English Name 2-(Benzoyloxy)-2-methylpropanoic acid
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES CC(C)(OC(=O)C1=CC=CC=C1)C(O)=O
InChIKey XGWKCHAQEYLCBD-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Benzoyloxy)-2-methylpropanoic acid (CAS: 58570-00-6)?

2-(Benzoyloxy)-2-methylpropanoic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 2-(Benzoyloxy)-2-methylpropanoic acid (CAS: 58570-00-6)?

2-(Benzoyloxy)-2-methylpropanoic acid is utilized in various industries, including pharmaceuticals, ...

Compound Q&A

What precautions should be taken when handling 2-(Benzoyloxy)-2-methylpropanoic acid (CAS: 58570-00-6)?

When handling 2-(Benzoyloxy)-2-methylpropanoic acid, it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...