Compound Q&A

What industries use 2-Naphthyl beta-D-glucopyranoside (CAS: 6044-30-0)?

Answer

2-Naphthyl beta-D-glucopyranoside
2-Naphthyl beta-D-glucopyranoside finds applications in the pharmaceutical industry for the synthesis of complex carbohydrates and drug intermediates. It is also used in the polymer industry for the modification of polymers through glycosylation reactions. Additionally, this compound is utilized in the development of sensors and semiconductors where its unique structural properties are advantageous.

About

CAS No 6044-30-0
English Name 2-Naphthyl beta-D-glucopyranoside
Molecular Formula C16H18O6
Molecular Weight 306.31 g/mol
SMILES C1=CC=C2C=C(C=CC2=C1)OC3C(C(C(C(O3)CO)O)O)O
InChIKey MWHKPYATGMFFPI-IBEHDNSVSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Naphthyl beta-D-glucopyranoside (CAS: 6044-30-0)?

2-Naphthyl beta-D-glucopyranoside is a crystalline compound with a molecular weight of approximately...

Compound Q&A

How is 2-Naphthyl beta-D-glucopyranoside (CAS: 6044-30-0) typically synthesized?

2-Naphthyl beta-D-glucopyranoside is often synthesized via a glycosylation reaction between naphthyl...

Compound Q&A

What precautions should be taken when handling 2-Naphthyl beta-D-glucopyranoside (CAS: 6044-30-0)?

When handling 2-Naphthyl beta-D-glucopyranoside, it is important to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...