Compound Q&A

How is 1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane (CAS: 3982-82-9) typically synthesized?

Answer

1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane
1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane is usually synthesized through a multistep process involving the reaction of triphenylsilane with methyl silanes in the presence of a catalytic amount of a Lewis acid such as aluminum chloride. The synthesis involves careful control of reaction conditions to achieve high yield and selectivity. The product is typically purified by distillation to ensure high purity.

About

CAS No 3982-82-9
English Name 1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane
Molecular Formula C28H32O2Si3
Molecular Weight 484.82 g/mol
SMILES C[Si](C)(O[Si](C)(c1ccccc1)c2ccccc2)O[Si](C)(c3ccccc3)c4ccccc4
InChIKey YFCVAZGXPLMNDG-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane (CAS: 3982-82-9)?

1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane is a highly symmetrical organosilicon compound. I...

Compound Q&A

What industries use 1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane (CAS: 3982-82-9)?

1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane is primarily used in the polymer industry for the...

Compound Q&A

What precautions should be taken when handling 1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane (CAS: 3982-82-9)?

When handling 1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane, it is important to follow standard...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...