Compound Q&A

What industries use 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride - 1-vinyl-2-pyrrolidinone (CAS: 131954-48-8)?

Answer

3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride - 1-vinyl-2-pyrrolidinone (1:1:1)
3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride - 1-vinyl-2-pyrrolidinone (CAS: 131954-48-8) is used in the pharmaceutical industry for the synthesis of polymers and as a monomer in the production of biomedical polymers. It is also utilized in the polymer industry for the development of functional polymers, and in the sensors industry for creating sensor materials with improved performance. Additionally, it finds applications in the semiconductor industry as a material for thin film formation.

About

English Name 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride - 1-vinyl-2-pyrrolidinone (1:1:1)
Molecular Formula C16H30ClN3O2
Molecular Weight 331.9 g/mol
SMILES CC(=C)C(=O)NCCC[N+](C)(C)C.C=CN1CCCC1=O.[Cl-]
InChIKey WAROVFJVCBYVHY-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride - 1-vinyl-2-pyrrolidinone (CAS: 131954-48-8)?

3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride - 1-vinyl-2-pyrrolidinone (CAS: 13195...

Compound Q&A

How is 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride - 1-vinyl-2-pyrrolidinone (CAS: 131954-48-8) typically synthesized?

3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride - 1-vinyl-2-pyrrolidinone (CAS: 13195...

Compound Q&A

What precautions should be taken when handling 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride - 1-vinyl-2-pyrrolidinone (CAS: 131954-48-8)?

When handling 3-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium chloride - 1-vinyl-2-pyrrolidino...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...