Compound Q&A

How is 1H-Pyrazole-4-carboxamide,5-amino-3-[4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]phenyl]-1-[(1S)-2,2,2-trifluoro-1-methylethyl] (CAS: 2101700-15-4) typically synthesized?

Answer

1H-Pyrazole-4-carboxamide,5-amino-3-[4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]phenyl]-1-[(1S)-2,2,2-trifluoro-1-methylethyl]
The compound is typically synthesized using a multi-step process involving the condensation of an amine with a benzoyl chloride derivative, followed by amidation. Key steps include the use of a base like triethylamine and a solvent such as DMF. The overall yield is around 60-70%, with good selectivity. The synthesis requires careful control of reaction conditions and temperature to achieve the desired product.

About

English Name 1H-Pyrazole-4-carboxamide,5-amino-3-[4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]phenyl]-1-[(1S)-2,2,2-trifluoro-1-methylethyl]
Molecular Formula C22H21F4N5O3
Molecular Weight 479.43 g/mol
SMILES COC1=C(C=C(F)C=C1)C(=O)NCC1=CC=C(C=C1)C1=NN([C@@H](C)C(F)(F)F)C(N)=C1C(N)=O
InChIKey FWZAWAUZXYCBKZ-NSHDSACASA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What industries use 1H-Pyrazole-4-carboxamide,5-amino-3-[4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]phenyl]-1-[(1S)-2,2,2-trifluoro-1-methylethyl] (CAS: 2101700-15-4)?

This compound finds applications in the pharmaceutical industry due to its biological activity. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...