Compound Q&A

What are the physical and chemical properties of 1,2,5-Trifluoro-3-nitrobenzene (CAS: 66684-57-9)?

Answer

1,2,5-Trifluoro-3-nitrobenzene
1,2,5-Trifluoro-3-nitrobenzene is a crystalline solid with a high melting point and a molecular weight of approximately 214.08 g/mol. It is moderately soluble in common organic solvents like acetic acid and acetone. The compound exhibits good reactivity towards nucleophiles, making it suitable for substitution reactions. It is also known for its stability in the presence of oxidizing agents.

About

CAS No 66684-57-9
English Name 1,2,5-Trifluoro-3-nitrobenzene
Molecular Formula C6H2F3NO2
Molecular Weight 177.08 g/mol
SMILES C1=C(C=C(C(=C1[N+](=O)[O-])F)F)F
InChIKey MXOQPGDHOAMPJW-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 1,2,5-Trifluoro-3-nitrobenzene (CAS: 66684-57-9) typically synthesized?

1,2,5-Trifluoro-3-nitrobenzene can be synthesized via the nitration of 1,2,5-trifluorobenzene in the...

Compound Q&A

What industries use 1,2,5-Trifluoro-3-nitrobenzene (CAS: 66684-57-9)?

1,2,5-Trifluoro-3-nitrobenzene is primarily used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 1,2,5-Trifluoro-3-nitrobenzene (CAS: 66684-57-9)?

When handling 1,2,5-Trifluoro-3-nitrobenzene, it is essential to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...