Compound Q&A

How is Tegoprazan (CAS: 942195-55-3) typically synthesized?

Answer

Tegoprazan
Tegoprazan (CAS: 942195-55-3) is usually synthesized via a multi-step process involving alkylation, ring closure, and amidation reactions. Key steps include the use of tert-butyldimethylsilyl chloride as a protecting group, followed by ring formation using a condensation agent. The final amidation step uses sodium hydride and an amide to form the desired product with a high yield and selectivity.

About

English Name Tegoprazan
Molecular Formula C20H19F2N3O3
Molecular Weight 387.39 g/mol
SMILES CC1=NC2=C(N1)C=C(C=C2OC3CCOC4=C3C(=CC(=C4)F)F)C(=O)N(C)C
InChIKey CLIQCDHNPDMGSL-HNNXBMFYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tegoprazan (CAS: 942195-55-3)?

Tegoprazan (CAS: 942195-55-3) is a crystalline compound with a molecular weight of approximately 365...

Compound Q&A

What industries use Tegoprazan (CAS: 942195-55-3)?

Tegoprazan (CAS: 942195-55-3) is primarily used in the pharmaceutical industry. It is an active ingr...

Compound Q&A

What precautions should be taken when handling Tegoprazan (CAS: 942195-55-3)?

When handling Tegoprazan (CAS: 942195-55-3), it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...