Compound Q&A

What are the physical and chemical properties of 6-O-alpha-D-Glucosyl-beta-cyclodextrin (CAS: 92517-02-7)?

Answer

6-O-alpha-D-Glucosyl-beta-cyclodextrin
6-O-alpha-D-Glucosyl-beta-cyclodextrin is a white to off-white crystalline powder with a molecular weight of approximately 1458.86 g/mol. It is slightly soluble in water and is known for its ability to form inclusion complexes. Chemically, it shows good stability in acidic and neutral conditions but is less stable in basic solutions. It is not reactive with common reagents and is generally considered safe for laboratory use.

About

CAS No 92517-02-7
English Name 6-O-alpha-D-Glucosyl-beta-cyclodextrin
Molecular Formula C48H80O40
Molecular Weight 1297.13 g/mol
SMILES C(C1C(C(C(C(O1)OCC2C3C(C(C(O2)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(C(C8O)O)OC9C(OC(O3)C(C9O)O)CO)CO)CO)CO)CO)CO)O)O)O)O)O)O
InChIKey XXFANTYPKDIONG-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is 6-O-alpha-D-Glucosyl-beta-cyclodextrin (CAS: 92517-02-7) typically synthesized?

6-O-alpha-D-Glucosyl-beta-cyclodextrin is typically synthesized through a glucosylation reaction. Th...

Compound Q&A

What industries use 6-O-alpha-D-Glucosyl-beta-cyclodextrin (CAS: 92517-02-7)?

6-O-alpha-D-Glucosyl-beta-cyclodextrin is used primarily in the pharmaceutical and food industries. ...

Compound Q&A

What precautions should be taken when handling 6-O-alpha-D-Glucosyl-beta-cyclodextrin (CAS: 92517-02-7)?

When handling 6-O-alpha-D-Glucosyl-beta-cyclodextrin, basic laboratory safety precautions should be ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...