Compound Q&A

What are the main uses of [3-Fluoro-2-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-12-0)?

Answer

[3-Fluoro-2-(trifluoromethyl)phenyl]boronic acid
[3-Fluoro-2-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-12-0) is primarily used as a key reagent in multicomponent reactions and as an intermediate in the synthesis of various pharmaceuticals and herbicides. It plays a vital role in organic chemistry due to its unique properties.

About

English Name [3-Fluoro-2-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H5BF4O2
Molecular Weight 207.92 g/mol
SMILES B(c1cccc(c1C(F)(F)F)F)(O)O
InChIKey BGSVFTCXIJCNOU-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:56

Related Q&A

Compound Q&A

What is [3-Fluoro-2-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-12-0)?

[3-Fluoro-2-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-12-0) is a boronic acid derivative wit...

Compound Q&A

Is [3-Fluoro-2-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-12-0) safe?

When handled properly, [3-Fluoro-2-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-12-0) is consid...

Compound Q&A

How should [3-Fluoro-2-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-12-0) be stored?

[3-Fluoro-2-(trifluoromethyl)phenyl]boronic acid (CAS: 850411-12-0) should be stored in a cool, dry ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...