Compound Q&A

What is 2-Methyl-2-propanyl 3-(1H-benzimidazol-2-yl)-1-piperidinecarboxylate (CAS: 1229000-10-5)?

Answer

2-Methyl-2-propanyl 3-(1H-benzimidazol-2-yl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 3-(1H-benzimidazol-2-yl)-1-piperidinecarboxylate (CAS: 1229000-10-5) is a chemical compound with a complex structure, featuring a benzimidazole ring and a piperidine carboxylate moiety. This compound has a molecular weight of approximately 322.3 g/mol and is typically found in a solid form. It exhibits characteristics such as solubility in organic solvents and certain physical properties like boiling point and melting point.

About

English Name 2-Methyl-2-propanyl 3-(1H-benzimidazol-2-yl)-1-piperidinecarboxylate
Molecular Formula C17H23N3O2
Molecular Weight 301.39 g/mol
SMILES O=C(N1CCCC(C1)c1nc2c([nH]1)cccc2)OC(C)(C)C
InChIKey NQJXCURWALTMNK-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:56

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 3-(1H-benzimidazol-2-yl)-1-piperidinecarboxylate (CAS: 1229000-10-5)?

2-Methyl-2-propanyl 3-(1H-benzimidazol-2-yl)-1-piperidinecarboxylate (CAS: 1229000-10-5) is primaril...

Compound Q&A

Is 2-Methyl-2-proanyl 3-(1H-benzimidazol-2-yl)-1-piperidinecarboxylate (CAS: 1229000-10-5) safe?

2-Methyl-2-proanyl 3-(1H-benzimidazol-2-yl)-1-piperidinecarboxylate (CAS: 1229000-10-5) is generally...

Compound Q&A

How should 2-Methyl-2-proanyl 3-(1H-benzimidazol-2-yl)-1-piperidinecarboxylate (CAS: 1229000-10-5) be stored?

2-Methyl-2-proanyl 3-(1H-benzimidazol-2-yl)-1-piperidinecarboxylate (CAS: 1229000-10-5) should be st...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...