Compound Q&A

What are the main uses of 1-Anilino-4,5-dihydroxy-8-nitro-9,10-anthraquinone (CAS: 20241-76-3)?

Answer

1-Anilino-4,5-dihydroxy-8-nitro-9,10-anthraquinone
1-Anilino-4,5-dihydroxy-8-nitro-9,10-anthraquinone (CAS: 20241-76-3) is primarily used in the synthesis of dyes and pigments due to its vibrant color and stability. It also finds applications in pharmaceuticals, where it can be used as an intermediate in the production of other compounds. Additionally, this compound is employed in analytical chemistry for its distinctive spectroscopic properties.

About

CAS No 20241-76-3
English Name 1-Anilino-4,5-dihydroxy-8-nitro-9,10-anthraquinone
Molecular Formula C20H12N2O6
Molecular Weight 376.32 g/mol
SMILES c1ccc(cc1)Nc2ccc(c3c2C(=O)c4c(ccc(c4C3=O)O)[N+](=O)[O-])O
InChIKey DYALWCKAJBVSBZ-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:56

Related Q&A

Compound Q&A

What is 1-Anilino-4,5-dihydroxy-8-nitro-9,10-anthraquinone (CAS: 20241-76-3)?

1-Anilino-4,5-dihydroxy-8-nitro-9,10-anthraquinone (CAS: 20241-76-3) is a complex organic compound w...

Compound Q&A

Is 1-Anilino-4,5-dihydroxy-8-nitro-9,10-anthraquinone (CAS: 20241-76-3) safe?

1-Anilino-4,5-dihydroxy-8-nitro-9,10-anthraquinone (CAS: 20241-76-3) is generally safe under proper ...

Compound Q&A

How should 1-Anilino-4,5-dihydroxy-8-nitro-9,10-anthraquinone (CAS: 20241-76-3) be stored?

1-Anilino-4,5-dihydroxy-8-nitro-9,10-anthraquinone (CAS: 20241-76-3) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...