Compound Q&A

How should Ganoderic acid E (CAS: 98665-14-6) be stored?

Answer

Ganoderic acid E
Ganoderic acid E (CAS: 98665-14-6) should be stored in a cool, dry place away from direct sunlight and high temperatures to maintain its stability. It is recommended to keep it in a sealed container to prevent moisture absorption and degradation.

About

CAS No 98665-14-6
English Name Ganoderic acid E
Molecular Formula C30H40O7
Molecular Weight 512.6 g/mol
SMILES CC(CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C1(CC(=O)C3=C2C(=O)CC4C3(CCC(=O)C4(C)C)C)C)C
InChIKey VBGDQDJVTLQGNO-JXLWEQSJSA-N
Last Updated: 2025-10-31 12:56

Related Q&A

Compound Q&A

What is Ganoderic acid E (CAS: 98665-14-6)?

Ganoderic acid E (CAS: 98665-14-6) is a triterpenoid compound isolated from the Ganoderma lucidum mu...

Compound Q&A

What are the main uses of Ganoderic acid E (CAS: 98665-14-6)?

Ganoderic acid E (CAS: 98665-14-6) is primarily used in the pharmaceutical industry for its potentia...

Compound Q&A

Is Ganoderic acid E (CAS: 98665-14-6) safe?

Ganoderic acid E (CAS: 98665-14-6) is generally considered safe for use in food and pharmaceutical p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...