Compound Q&A

What is 4,4'-(2-Pyridinylmethylene)diphenol (CAS: 603-41-8)?

Answer

4,4'-(2-Pyridinylmethylene)diphenol
4,4'-(2-Pyridinylmethylene)diphenol, also known as 2,2'-Dipyridylmethanediol, is a chemical compound with the CAS number 603-41-8. It is a phenolic compound characterized by its molecular structure containing two pyridinylmethylene groups bridged between two phenol moieties. This compound shows interesting spectroscopic and electronic properties, making it useful in various applications.

About

CAS No 603-41-8
English Name 4,4'-(2-Pyridinylmethylene)diphenol
Molecular Formula C18H15NO2
Molecular Weight 277.32 g/mol
SMILES Oc1ccc(cc1)C(c1ccccn1)c1ccc(cc1)O
InChIKey LJROKJGQSPMTKB-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:56

Related Q&A

Compound Q&A

What are the main uses of 4,4'-(2-Pyridinylmethylene)diphenol (CAS: 603-41-8)?

4,4'-(2-Pyridinylmethylene)diphenol is primarily used in the field of analytical chemistry as a chro...

Compound Q&A

Is 4,4'-(2-Pyridinylmethylene)diphenol (CAS: 603-41-8) safe?

4,4'-(2-Pyridinylmethylene)diphenol (CAS: 603-41-8) is generally considered safe when handled proper...

Compound Q&A

How should 4,4'-(2-Pyridinylmethylene)diphenol (CAS: 603-41-8) be stored?

4,4'-(2-Pyridinylmethylene)diphenol (CAS: 603-41-8) should be stored in a cool, dry place away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...