Compound Q&A

What are the main uses of Methyl 1-oxo-5-indanecarboxylate (CAS: 68634-02-6)?

Answer

Methyl 1-oxo-5-indanecarboxylate
Methyl 1-oxo-5-indanecarboxylate (CAS: 68634-02-6) is primarily used as a precursor in the synthesis of other chemical compounds. It has applications in pharmaceuticals, where it is used in the development of new drugs, and in research, where it serves as a building block for organic synthesis.

About

CAS No 68634-02-6
English Name Methyl 1-oxo-5-indanecarboxylate
Molecular Formula C11H10O3
Molecular Weight 190.19799999999995 g/mol
SMILES COC(=O)C1=CC2=C(C=C1)C(=O)CC2
InChIKey YYKBHCRUMAMBPY-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:56

Related Q&A

Compound Q&A

What is Methyl 1-oxo-5-indanecarboxylate (CAS: 68634-02-6)?

Methyl 1-oxo-5-indanecarboxylate (CAS: 68634-02-6) is a derivative of an indane carboxylic acid with...

Compound Q&A

Is Methyl 1-oxo-5-indanecarboxylate (CAS: 68634-02-6) safe?

Methyl 1-oxo-5-indanecarboxylate (CAS: 68634-02-6) is generally safe when handled with appropriate p...

Compound Q&A

How should Methyl 1-oxo-5-indanecarboxylate (CAS: 68634-02-6) be stored?

Methyl 1-oxo-5-indanecarboxylate (CAS: 68634-02-6) should be stored in a cool, dry place away from d...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...