Compound Q&A

How should (2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid (CAS: 7706-67-4) be stored?

Answer

(2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid
(2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid should be stored in tightly sealed containers to protect it from moisture and light. Store in a cool, dry place away from sources of heat and direct sunlight. The optimal storage temperature is between 15-25°C (59-77°F) with a maximum relative humidity of 50%. Keep the compound away from incompatible materials such as strong acids, bases, and oxidizing agents to prevent chemical reactions and hazards.

About

CAS No 7706-67-4
English Name (2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid
Molecular Formula C12H14O4
Molecular Weight 222.23999999999998 g/mol
SMILES CC(=CC(=O)O)C1=C(C=C(C=C1)OC)OC
InChIKey VNLOISSPTMDCIF-SOFGYWHQSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is (2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid (CAS: 7706-67-4)?

(2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid, also known as 2-(2,4-dimethoxyphenyl)acrylic acid, is ...

Compound Q&A

What are the main uses of (2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid (CAS: 7706-67-4)?

(2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid is primarily used in the pharmaceutical industry for th...

Compound Q&A

Is (2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid (CAS: 7706-67-4) safe?

(2E)-3-(2,4-Dimethoxyphenyl)-2-butenoic acid is generally considered safe under normal handling cond...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...