Compound Q&A

What are the main uses of methyl 2,4-diamino-3-fluoro-5-nitrobenzoate (CAS: 918321-18-3)?

Answer

methyl 2,4-diamino-3-fluoro-5-nitrobenzoate
Methyl 2,4-diamino-3-fluoro-5-nitrobenzoate (CAS: 918321-18-3) is primarily used in pharmaceuticals as an intermediate in the synthesis of other compounds and in research for its reactivity and unique structural features. It can also be utilized in the chemical industry for its specific functional groups.

About

English Name methyl 2,4-diamino-3-fluoro-5-nitrobenzoate
Molecular Formula C8H8FN3O4
Molecular Weight 229.17 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1N)F)N)[N+](=O)[O-]
InChIKey RBALXPMHIYPOBI-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is methyl 2,4-diamino-3-fluoro-5-nitrobenzoate (CAS: 918321-18-3)?

Methyl 2,4-diamino-3-fluoro-5-nitrobenzoate (CAS: 918321-18-3) is a organic compound with the molecu...

Compound Q&A

Is methyl 2,4-diamino-3-fluoro-5-nitrobenzoate (CAS: 918321-18-3) safe?

Methyl 2,4-diamino-3-fluoro-5-nitrobenzoate (CAS: 918321-18-3) is generally safe under controlled co...

Compound Q&A

How should methyl 2,4-diamino-3-fluoro-5-nitrobenzoate (CAS: 918321-18-3) be stored?

Methyl 2,4-diamino-3-fluoro-5-nitrobenzoate (CAS: 918321-18-3) should be stored in a well-ventilated...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...