Compound Q&A

Is 2,4-Dimethyl-5-nitropyridine (CAS: 1074-99-3) safe?

Answer

2,4-Dimethyl-5-nitropyridine
2,4-Dimethyl-5-nitropyridine (CAS: 1074-99-3) is generally considered safe when handled properly. However, it is toxic and can cause irritation to the eyes, skin, and respiratory system. Proper protective measures, such as gloves, goggles, and a lab coat, should be used during handling. Ingestion or inhalation should be avoided.

About

CAS No 1074-99-3
English Name 2,4-Dimethyl-5-nitropyridine
Molecular Formula C7H8N2O2
Molecular Weight 152.15 g/mol
SMILES CC1=CC(=NC=C1[N+](=O)[O-])C
InChIKey GMAJNANLBOHCAU-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is 2,4-Dimethyl-5-nitropyridine (CAS: 1074-99-3)?

2,4-Dimethyl-5-nitropyridine (CAS: 1074-99-3) is an organic compound with the molecular formula C7H7...

Compound Q&A

What are the main uses of 2,4-Dimethyl-5-nitropyridine (CAS: 1074-99-3)?

2,4-Dimethyl-5-nitropyridine (CAS: 1074-99-3) is primarily used as a precursor in the pharmaceutical...

Compound Q&A

How should 2,4-Dimethyl-5-nitropyridine (CAS: 1074-99-3) be stored?

2,4-Dimethyl-5-nitropyridine (CAS: 1074-99-3) should be stored in a well-ventilated area away from s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...