Compound Q&A

How should (2,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-30-1) be stored?

Answer

(2,4-Difluorophenyl)(hydroxy)acetic acid
(2,4-Difluorophenyl)(hydroxy)acetic acid should be stored in a cool, dry place, protected from light. It should be kept in a tightly sealed container to prevent moisture absorption. The temperature should not exceed 30°C, and it should be kept away from heat and open flames. Avoid contact with strong oxidizers and keep the storage area accessible to emergency response equipment.

About

English Name (2,4-Difluorophenyl)(hydroxy)acetic acid
Molecular Formula C8H6F2O3
Molecular Weight 188.13 g/mol
SMILES C1=CC(=C(C=C1F)F)C(C(=O)O)O
InChIKey RRRQFGNNRJHLNV-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is (2,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-30-1)?

(2,4-Difluorophenyl)(hydroxy)acetic acid, also known as 2,4-difluorophenylacetic acid, is an organic...

Compound Q&A

What are the main uses of (2,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-30-1)?

(2,4-Difluorophenyl)(hydroxy)acetic acid is primarily used in the pharmaceutical industry as an inte...

Compound Q&A

Is (2,4-Difluorophenyl)(hydroxy)acetic acid (CAS: 132741-30-1) safe?

(2,4-Difluorophenyl)(hydroxy)acetic acid is generally considered safe when handled with proper preca...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...