Compound Q&A

What is Ethyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 135995-46-9)?

Answer

Ethyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate
Ethyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate is an organic compound with the CAS number 135995-46-9. It features a bromine atom attached to an imidazo[1,2-a]pyridine ring, with an ethyl ester group at position 2. This compound is used in various chemical reactions and as an intermediate in the synthesis of other compounds.

About

English Name Ethyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate
Molecular Formula C10H9BrN2O2
Molecular Weight 269.1 g/mol
SMILES CCOC(=O)c1cn2c(n1)cccc2Br
InChIKey VJMNOJHFYDPFKP-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What are the main uses of Ethyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 135995-46-9)?

Ethyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate is primarily used as an intermediate in the synthe...

Compound Q&A

Is Ethyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 135995-46-9) safe?

Ethyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate is generally safe when handled with appropriate pr...

Compound Q&A

How should Ethyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS: 135995-46-9) be stored?

Ethyl 5-bromoimidazo[1,2-a]pyridine-2-carboxylate should be stored in a cool, dry place away from di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...