Compound Q&A

What are the main uses of 2-Methoxyphenyl 2-acetoxybenzoate (CAS: 55482-89-8)?

Answer

2-Methoxyphenyl 2-acetoxybenzoate
2-Methoxyphenyl 2-acetoxybenzoate (CAS: 55482-89-8) is primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. It plays a crucial role in the development of topical analgesics and anti-inflammatory drugs. Additionally, it is utilized in research and development for its unique chemical properties and reactivity.

About

CAS No 55482-89-8
English Name 2-Methoxyphenyl 2-acetoxybenzoate
Molecular Formula C16H14O5
Molecular Weight 286.28 g/mol
SMILES CC(=O)OC1=CC=CC=C1C(=O)OC2=CC=CC=C2OC
InChIKey HSJFYRYGGKLQBT-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is 2-Methoxyphenyl 2-acetoxybenzoate (CAS: 55482-89-8)?

2-Methoxyphenyl 2-acetoxybenzoate (CAS: 55482-89-8) is an organic compound with the molecular formul...

Compound Q&A

Is 2-Methoxyphenyl 2-acetoxybenzoate (CAS: 55482-89-8) safe?

2-Methoxyphenyl 2-acetoxybenzoate (CAS: 55482-89-8) is generally considered safe when used appropria...

Compound Q&A

How should 2-Methoxyphenyl 2-acetoxybenzoate (CAS: 55482-89-8) be stored?

2-Methoxyphenyl 2-acetoxybenzoate (CAS: 55482-89-8) should be stored in a tightly sealed container t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...