Compound Q&A

How should 3H-Imidazo[4,5-b]pyridine-5-carboxylic acid (CAS: 1019108-05-4) be stored?

Answer

3H-Imidazo[4,5-b]pyridine-5-carboxylic acid
3H-Imidazo[4,5-b]pyridine-5-carboxylic acid (CAS: 1019108-05-4) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent exposure to moisture and air. The storage temperature should be maintained between 15-25°C. Avoid storing it near incompatible substances to ensure safety during handling and transportation.

About

English Name 3H-Imidazo[4,5-b]pyridine-5-carboxylic acid
Molecular Formula C7H5N3O2
Molecular Weight 163.14 g/mol
SMILES C1=CC(=NC2=C1NC=N2)C(=O)O
InChIKey NRVIZYWYHXROKA-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is 3H-Imidazo[4,5-b]pyridine-5-carboxylic acid (CAS: 1019108-05-4)?

3H-Imidazo[4,5-b]pyridine-5-carboxylic acid (CAS: 1019108-05-4) is an organic compound with a molecu...

Compound Q&A

What are the main uses of 3H-Imidazo[4,5-b]pyridine-5-carboxylic acid (CAS: 1019108-05-4)?

3H-Imidazo[4,5-b]pyridine-5-carboxylic acid (CAS: 1019108-05-4) is primarily used in the pharmaceuti...

Compound Q&A

Is 3H-Imidazo[4,5-b]pyridine-5-carboxylic acid (CAS: 1019108-05-4) safe?

3H-Imidazo[4,5-b]pyridine-5-carboxylic acid (CAS: 1019108-05-4) is generally safe under normal handl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...