Compound Q&A

What are the main uses of 2,4,6-Trivinylcyclotriboroxane pyridine complex (CAS: 95010-17-6)?

Answer

2,4,6-Trivinylcyclotriboroxane pyridine complex
2,4,6-Trivinylcyclotriboroxane pyridine complex is used in catalysis, as a ligand in coordination chemistry, and in the development of functional materials. It shows promise in pharmaceuticals for medicinal chemistry and as a ligand in drug discovery.

About

CAS No 95010-17-6
English Name 2,4,6-Trivinylcyclotriboroxane pyridine complex
Molecular Formula C11H14B3NO3
Molecular Weight 240.67 g/mol
SMILES B1(OB(OB(O1)C=C)C=C)C=C.C1=CC=NC=C1
InChIKey YLHJACXHRQQNQR-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is 2,4,6-Trivinylcyclotriboroxane pyridine complex (CAS: 95010-17-6)?

2,4,6-Trivinylcyclotriboroxane pyridine complex (CAS: 95010-17-6) is a unique organic-inorganic hybr...

Compound Q&A

Is 2,4,6-Trivinylcyclotriboroxane pyridine complex (CAS: 95010-17-6) safe?

2,4,6-Trivinylcyclotriboroxane pyridine complex is generally safe when handled with appropriate prec...

Compound Q&A

How should 2,4,6-Trivinylcyclotriboroxane pyridine complex (CAS: 95010-17-6) be stored?

Store 2,4,6-Trivinylcyclotriboroxane pyridine complex in a cool, dark place away from direct sunligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...