Compound Q&A

Is 2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid (CAS: 53949-53-4) safe?

Answer

2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid
2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid (BMPPA) is generally considered safe when used as directed. However, it should be handled with caution due to its strong odor and potential skin and eye irritation. Protective equipment such as gloves and goggles should be worn during handling.

About

CAS No 53949-53-4
English Name 2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid
Molecular Formula C13H18O3
Molecular Weight 222.28 g/mol
SMILES CC(C)C(O)c1ccc(cc1)C(C)C(=O)O
InChIKey RMOQYHYFRKTDRI-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is 2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid (CAS: 53949-53-4)?

2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid, also known as BMPPA, is a chemical compound wi...

Compound Q&A

What are the main uses of 2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid (CAS: 53949-53-4)?

2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid (BMPPA) is primarily used as a research tool in...

Compound Q&A

How should 2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid (CAS: 53949-53-4) be stored?

2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid (BMPPA) should be stored in a cool, dry place a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...