Compound Q&A

How should 4,4'-Biphenyldisulfonic acid (CAS: 5314-37-4) be stored?

Answer

4,4'-Biphenyldisulfonic acid
4,4'-Biphenyldisulfonic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in tightly sealed containers to prevent moisture absorption. Avoid contact with incompatible materials such as acids and oxidizers. Properly labeled and secured containers should be used to ensure safety during storage and transportation.

About

CAS No 5314-37-4
English Name 4,4'-Biphenyldisulfonic acid
Molecular Formula C12H10O6S2
Molecular Weight 314.34 g/mol
SMILES C1=CC(=CC=C1C2=CC=C(C=C2)S(=O)(=O)O)S(=O)(=O)O
InChIKey ABSXMLODUTXQDJ-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is 4,4'-Biphenyldisulfonic acid (CAS: 5314-37-4)?

4,4'-Biphenyldisulfonic acid, with CAS number 5314-37-4, is a dianhydride compound used in various a...

Compound Q&A

What are the main uses of 4,4'-Biphenyldisulfonic acid (CAS: 5314-37-4)?

4,4'-Biphenyldisulfonic acid is primarily used in the synthesis of polyimide resins, which are widel...

Compound Q&A

Is 4,4'-Biphenyldisulfonic acid (CAS: 5314-37-4) safe?

4,4'-Biphenyldisulfonic acid is generally safe when handled with proper protective measures. Users s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...