Compound Q&A

How should 4-Methyl-3-nitrobenzenesulfonyl chloride (CAS: 616-83-1) be stored?

Answer

4-Methyl-3-nitrobenzenesulfonyl chloride
To store 4-Methyl-3-nitrobenzenesulfonyl chloride, maintain it in a cool, dry place away from direct sunlight and heat. Store it in a tightly closed container to prevent moisture and contamination. Optimal storage conditions include a temperature range of 20-25°C (68-77°F) and a relative humidity below 60%.

About

CAS No 616-83-1
English Name 4-Methyl-3-nitrobenzenesulfonyl chloride
Molecular Formula C7H6ClNO4S
Molecular Weight 235.65 g/mol
SMILES CC1=C(C=C(C=C1)S(=O)(=O)Cl)[N+](=O)[O-]
InChIKey OQFYBGANSUNUAO-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is 4-Methyl-3-nitrobenzenesulfonyl chloride (CAS: 616-83-1)?

4-Methyl-3-nitrobenzenesulfonyl chloride is an aromatic compound with the chemical formula C9H7NO4S....

Compound Q&A

What are the main uses of 4-Methyl-3-nitrobenzenesulfonyl chloride (CAS: 616-83-1)?

4-Methyl-3-nitrobenzenesulfonyl chloride is primarily used in the synthesis of pharmaceuticals, dyes...

Compound Q&A

Is 4-Methyl-3-nitrobenzenesulfonyl chloride (CAS: 616-83-1) safe?

4-Methyl-3-nitrobenzenesulfonyl chloride can be hazardous due to its reactivity and corrosive nature...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...