Compound Q&A

What are the main uses of 1-Butyl-3-methyl-1H-imidazol-3-ium trifluoroacetate (CAS: 174899-94-6)?

Answer

1-Butyl-3-methyl-1H-imidazol-3-ium trifluoroacetate
1-Butyl-3-methyl-1H-imidazol-3-ium trifluoroacetate is primarily used as a salt in various applications. It serves as a pH adjuster, surfactant, and stabilizer in pharmaceuticals and cosmetics. Additionally, it is used in the synthesis of other organic compounds and as a reagent in analytical chemistry.

About

English Name 1-Butyl-3-methyl-1H-imidazol-3-ium trifluoroacetate
Molecular Formula C10H15F3N2O2
Molecular Weight 252.23 g/mol
SMILES CCCCN1C=C[N+](=C1)C.C(=O)(C(F)(F)F)[O-]
InChIKey QPDGLRRWSBZCHP-UHFFFAOYSA-M
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is 1-Butyl-3-methyl-1H-imidazol-3-ium trifluoroacetate (CAS: 174899-94-6)?

1-Butyl-3-methyl-1H-imidazol-3-ium trifluoroacetate is an organic compound with the CAS number 17489...

Compound Q&A

Is 1-Butyl-3-methyl-1H-imidazol-3-ium trifluoroacetate (CAS: 174899-94-6) safe?

1-Butyl-3-methyl-1H-imidazol-3-ium trifluoroacetate is generally safe when handled properly. Users s...

Compound Q&A

How should 1-Butyl-3-methyl-1H-imidazol-3-ium trifluoroacetate (CAS: 174899-94-6) be stored?

1-Butyl-3-methyl-1H-imidazol-3-ium trifluoroacetate should be stored in a cool, dry, and well-ventil...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...