Compound Q&A

What is (2S)-2-Hydroxy-4-phenylbutanoic acid (CAS: 115016-95-0)?

Answer

(2S)-2-Hydroxy-4-phenylbutanoic acid
(2S)-2-Hydroxy-4-phenylbutanoic acid, also known as 4-Phenyl-2-hydroxybutanoic acid, is a chemical compound with a molecular formula of C9H10O3. It is a white crystalline solid with a melting point of 158-159°C. This compound is water-soluble and has a pKa of approximately 3.2. It is used in pharmaceuticals, such as in the synthesis of certain drugs, and in research as a building block for other organic compounds.

About

English Name (2S)-2-Hydroxy-4-phenylbutanoic acid
Molecular Formula C10H12O3
Molecular Weight 180.2 g/mol
SMILES C1=CC=C(C=C1)CCC(C(=O)O)O
InChIKey JNJCEALGCZSIGB-VIFPVBQESA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What are the main uses of (2S)-2-Hydroxy-4-phenylbutanoic acid (CAS: 115016-95-0)?

(2S)-2-Hydroxy-4-phenylbutanoic acid is primarily used in the pharmaceutical industry for the synthe...

Compound Q&A

Is (2S)-2-Hydroxy-4-phenylbutanoic acid (CAS: 115016-95-0) safe?

(2S)-2-Hydroxy-4-phenylbutanoic acid is generally considered safe for intended uses, but users shoul...

Compound Q&A

How should (2S)-2-Hydroxy-4-phenylbutanoic acid (CAS: 115016-95-0) be stored?

(2S)-2-Hydroxy-4-phenylbutanoic acid should be stored in a cool, dry place away from direct heat and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...