Compound Q&A

What is 7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 1810-74-8)?

Answer

7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline
7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline is a chemical compound with the CAS number 1810-74-8. It is a complex organic molecule with a quinoline backbone, featuring a methoxy group, three methyl groups, and a double bond between the first and second carbon atoms. This compound is typically used in pharmaceuticals and as a research reagent due to its structural complexity and potential biological activities.

About

CAS No 1810-74-8
English Name 7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline
Molecular Formula C13H17NO
Molecular Weight 203.29 g/mol
SMILES COc1ccc2C(=CC(C)(C)Nc2c1)C
InChIKey VNIQAUZZZWOJPT-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What are the main uses of 7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 1810-74-8)?

7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline is primarily used in the pharmaceutical industry as a...

Compound Q&A

Is 7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 1810-74-8) safe?

7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 1810-74-8) is generally considered safe when ha...

Compound Q&A

How should 7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 1810-74-8) be stored?

7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 1810-74-8) should be stored in a cool, dry plac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...