Compound Q&A

How should 3-(3,4-Dihydroxyphenyl)-2-oxopropanoic acid (CAS: 4228-66-4) be stored?

Answer

3-(3,4-Dihydroxyphenyl)-2-oxopropanoic acid
3-(3,4-Dihydroxyphenyl)-2-oxopropanoic acid should be stored in a cool, dry place away from direct sunlight and heat sources. Keep it in a tightly sealed container to protect from moisture and contamination. It is recommended to store at a temperature not exceeding 25°C to maintain its stability and effectiveness.

About

CAS No 4228-66-4
English Name 3-(3,4-Dihydroxyphenyl)-2-oxopropanoic acid
Molecular Formula C9H8O5
Molecular Weight 196.16 g/mol
SMILES C1=CC(=C(C=C1CC(=O)C(=O)O)O)O
InChIKey LQQFFJFGLSKYIR-UHFFFAOYSA-N
Last Updated: 2025-10-31 12:55

Related Q&A

Compound Q&A

What is 3-(3,4-Dihydroxyphenyl)-2-oxopropanoic acid (CAS: 4228-66-4)?

3-(3,4-Dihydroxyphenyl)-2-oxopropanoic acid, also known as chlorogenic acid, is a natural phenolic c...

Compound Q&A

What are the main uses of 3-(3,4-Dihydroxyphenyl)-2-oxopropanoic acid (CAS: 4228-66-4)?

3-(3,4-Dihydroxyphenyl)-2-oxopropanoic acid is primarily used in the pharmaceutical industry as an a...

Compound Q&A

Is 3-(3,4-Dihydroxyphenyl)-2-oxopropanoic acid (CAS: 4228-66-4) safe?

3-(3,4-Dihydroxyphenyl)-2-oxopropanoic acid is generally considered safe when used as directed. Howe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...