Compound Q&A

How should 1,1'-(2,2-Diphenyl-1,1-ethenediyl)bis(4-bromobenzene) (CAS: 859315-37-0) be stored?

Answer

1,1'-(2,2-Diphenyl-1,1-ethenediyl)bis(4-bromobenzene)
1,1'-(2,2-Diphenyl-1,1-ethenediyl)bis(4-bromobenzene) should be stored in a cool, dry place, protected from light and moisture. It is advisable to keep the compound in a tightly sealed container to prevent degradation. Proper ventilation should be ensured during storage to avoid the accumulation of flammable gases.

About

English Name 1,1'-(2,2-Diphenyl-1,1-ethenediyl)bis(4-bromobenzene)
Molecular Formula C26H18Br2
Molecular Weight 490.24 g/mol
SMILES Brc4ccc(\C(=C(/c1ccccc1)c2ccccc2)c3ccc(Br)cc3)cc4
InChIKey LUSFLSAYXQSMPB-UHFFFAOYSA-N
Last Updated: 2025-10-30 11:43

Related Q&A

Compound Q&A

What is 1,1'-(2,2-Diphenyl-1,1-ethenediyl)bis(4-bromobenzene) (CAS: 859315-37-0)?

1,1'-(2,2-Diphenyl-1,1-ethenediyl)bis(4-bromobenzene) is a complex organic compound with the CAS num...

Compound Q&A

What are the main uses of 1,1'-(2,2-Diphenyl-1,1-ethenediyl)bis(4-bromobenzene) (CAS: 859315-37-0)?

1,1'-(2,2-Diphenyl-1,1-ethenediyl)bis(4-bromobenzene) is primarily used in research for its unique e...

Compound Q&A

Is 1,1'-(2,2-Diphenyl-1,1-ethenediyl)bis(4-bromobenzene) (CAS: 859315-37-0) safe?

1,1'-(2,2-Diphenyl-1,1-ethenediyl)bis(4-bromobenzene) is generally considered safe for laboratory us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...