Compound Q&A

How should naphtho[2,3-a]naphtho[2'',3'':6',7']indolo[3',2':7,8]naphtho[2,3-i]carbazole-5,7,12,17,19,24(6H,18H)-hexone (CAS: 2172-33-0) be stored?

Answer

Naphtho[2,3-a]naphtho[2'',3'':6',7']indolo[3',2':7,8]naphtho[2,3-i]carbazole-5,7,12,17,19,24(6H,18H)-hexone
This compound should be stored in a cool, dry place away from direct sunlight and sources of heat. It should be kept in a tightly sealed container to prevent degradation and ensure stability. Proper labeling and storage at a controlled temperature are essential to maintain the integrity of the compound during storage.

About

CAS No 2172-33-0
English Name Naphtho[2,3-a]naphtho[2'',3'':6',7']indolo[3',2':7,8]naphtho[2,3-i]carbazole-5,7,12,17,19,24(6H,18H)-hexone
Molecular Formula C42H18N2O6
Molecular Weight 646.61 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C4=C(C=C3)C5=C(N4)C6=C(C=C5)C(=O)C7=C(C6=O)C=CC8=C7NC9=C8C=CC1=C9C(=O)C2=CC=CC=C2C1=O
InChIKey CVWSULASWLZVCH-UHFFFAOYSA-N
Last Updated: 2025-10-30 11:43

Related Q&A

Compound Q&A

What is naphtho[2,3-a]naphtho[2'',3'':6',7']indolo[3',2':7,8]naphtho[2,3-i]carbazole-5,7,12,17,19,24(6H,18H)-hexone (CAS: 2172-33-0)?

Naphtho[2,3-a]naphtho[2'',3'':6',7']indolo[3',2':7,8]naphtho[2,3-i]carbazole-5,7,12,17,19,24(6H,18H)...

Compound Q&A

What are the main uses of naphtho[2,3-a]naphtho[2'',3'':6',7']indolo[3',2':7,8]naphtho[2,3-i]carbazole-5,7,12,17,19,24(6H,18H)-hexone (CAS: 2172-33-0)?

This compound is primarily used in the synthesis of advanced materials, particularly in the developm...

Compound Q&A

Is naphtho[2,3-a]naphtho[2'',3'':6',7']indolo[3',2':7,8]naphtho[2,3-i]carbazole-5,7,12,17,19,24(6H,18H)-hexone (CAS: 2172-33-0) safe?

This compound is generally considered safe for handling under standard laboratory conditions, provid...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...