Compound Q&A

Is 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride (CAS: 346451-15-8) safe?

Answer

1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride
The safety of 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride (CAS: 346451-15-8) depends on the context of its use. In general, it is considered safe when used as directed for its intended applications. However, proper handling procedures, such as wearing appropriate personal protective equipment and following laboratory safety guidelines, are essential to minimize potential risks. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information.

About

English Name 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride
Molecular Formula C30H28Cl2N2
Molecular Weight 560.4 g/mol
SMILES ClC1=CC=C(C(N2CCN(C(C3=CC=C(Cl)C=C3)C4=CC=CC=C4)CC2)C5=CC=CC=C5)C=C1.[H]Cl.[H]Cl
InChIKey ZHKWYPRSELVIIG-UHFFFAOYSA-N
Last Updated: 2025-10-30 11:43

Related Q&A

Compound Q&A

What is 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride (CAS: 346451-15-8)?

1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride is a complex organic compound with t...

Compound Q&A

What are the main uses of 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride (CAS: 346451-15-8)?

1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride (CAS: 346451-15-8) is primarily used...

Compound Q&A

How should 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochloride (CAS: 346451-15-8) be stored?

To ensure the stability and integrity of 1,4-Bis[(4-chlorophenyl)phenylmethyl]piperazine dihydrochlo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...