Compound Q&A

What is 1-Benzyl-1H-indole-3-carboxylic acid (CAS: 27018-76-4)?

Answer

1-Benzyl-1H-indole-3-carboxylic acid
1-Benzyl-1H-indole-3-carboxylic acid is a complex organic compound with a benzyl substituent and an indole ring structure. It has a chemical formula of C14H12N2O2 and is often used in the pharmaceutical and chemical synthesis industries due to its structural features.

About

CAS No 27018-76-4
English Name 1-Benzyl-1H-indole-3-carboxylic acid
Molecular Formula C16H13NO2
Molecular Weight 251.29 g/mol
SMILES C1=CC=C(C=C1)CN2C=C(C3=CC=CC=C32)C(=O)O
InChIKey LVYDDRHDOKXFMW-UHFFFAOYSA-N
Last Updated: 2025-10-30 11:43

Related Q&A

Compound Q&A

What are the main uses of 1-Benzyl-1H-indole-3-carboxylic acid (CAS: 27018-76-4)?

1-Benzyl-1H-indole-3-carboxylic acid is primarily used in pharmaceutical research for developing new...

Compound Q&A

Is 1-Benzyl-1H-indole-3-carboxylic acid (CAS: 27018-76-4) safe?

1-Benzyl-1H-indole-3-carboxylic acid is generally considered safe when handled with proper precautio...

Compound Q&A

How should 1-Benzyl-1H-indole-3-carboxylic acid (CAS: 27018-76-4) be stored?

1-Benzyl-1H-indole-3-carboxylic acid should be stored in a tightly sealed container in a cool, dry p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...