Compound Q&A

What is trans-3-(Tert-butoxycarbonylamino)cyclobutanecarboxylic acid (CAS: 939400-34-7)?

Answer

trans-3-(Tert-butoxycarbonylamino)cyclobutanecarboxylic acid
Trans-3-(Tert-butoxycarbonylamino)cyclobutanecarboxylic acid is a cyclic amino acid derivative with a unique structural configuration. It is used in pharmaceutical research as a key intermediate. This compound features a cyclic structure with a tert-butoxycarbonyl group attached to the amino group, making it an important tool in the synthesis of various bioactive molecules.

About

English Name trans-3-(Tert-butoxycarbonylamino)cyclobutanecarboxylic acid
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC(C)(C)OC(=O)NC1CC(C1)C(=O)O
InChIKey KLCYDBAYYYVNFM-LJGSYFOKSA-N
Last Updated: 2025-10-30 11:43

Related Q&A

Compound Q&A

What are the main uses of trans-3-(Tert-butoxycarbonylamino)cyclobutanecarboxylic acid (CAS: 939400-34-7)?

Trans-3-(Tert-butoxycarbonylamino)cyclobutanecarboxylic acid is primarily used as a key intermediate...

Compound Q&A

Is trans-3-(Tert-butoxycarbonylamino)cyclobutanecarboxylic acid (CAS: 939400-34-7) safe?

Trans-3-(Tert-butoxycarbonylamino)cyclobutanecarboxylic acid is generally safe when handled with app...

Compound Q&A

How should trans-3-(Tert-butoxycarbonylamino)cyclobutanecarboxylic acid (CAS: 939400-34-7) be stored?

Trans-3-(Tert-butoxycarbonylamino)cyclobutanecarboxylic acid should be stored in a cool, dry place a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...