Compound Q&A

Are there alternatives to Boron trifluoride phenol complex (CAS: 462-05-5) in synthesis?

Answer

Boron trifluoride phenol complex
There are several alternatives to Boron trifluoride phenol complex (CAS: 462-05-5) that can be used in synthesis, depending on the specific requirements of the reaction. Common alternatives include boron trifluoride etherate and boron trifluoride diethyl ether complex. These alternatives offer similar reactivity but may have different solubility and compatibility issues.

About

CAS No 462-05-5
English Name Boron trifluoride phenol complex
Molecular Formula C12H12BF3O2
Molecular Weight 256.03 g/mol
SMILES B(F)(F)F.C1=CC=C(C=C1)O.C1=CC=C(C=C1)O
InChIKey OQORKFSQJPQHSZ-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What regulatory guidelines apply to Boron trifluoride phenol complex (CAS: 462-05-5)?

Boron trifluoride phenol complex (CAS: 462-05-5) falls under the classification of a hazardous chemi...

Compound Q&A

What is the market or research trend for Boron trifluoride phenol complex (CAS: 462-05-5)?

The market for Boron trifluoride phenol complex (CAS: 462-05-5) is primarily driven by its use in or...

Compound Q&A

How should waste containing Boron trifluoride phenol complex (CAS: 462-05-5) be handled?

Waste containing Boron trifluoride phenol complex (CAS: 462-05-5) should be managed according to haz...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...