Compound Q&A

How is 4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 744209-63-0) typically synthesized?

Answer

4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine can be synthesized via the reaction of 4-chloropyrrolo[2,3-b]pyridine with phenylsulfonyl chloride in the presence of a base, such as triethylamine. The yield is typically around 70-80%, and the reaction is carried out in an inert solvent like dichloromethane. The reaction is selective and proceeds under mild conditions.

About

English Name 4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Molecular Formula C13H9ClN2O2S
Molecular Weight 292.75 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(C=CN=C32)Cl
InChIKey ZWIKJILDMNXRAR-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 744209-63-0)?

4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a crystalline solid with a molecular weight...

Compound Q&A

What industries use 4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 744209-63-0)?

4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 744209-63-0)?

When handling 4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, it is important to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...