Compound Q&A

What are the physical and chemical properties of 1-[8-(2-Chlorophenyl)-9-(4-chlorophenyl)-9H-purin-6-yl]-4-(ethylamino)-4-piperidinecarboxamide (CAS: 686344-29-6)?

Answer

1-[8-(2-Chlorophenyl)-9-(4-chlorophenyl)-9H-purin-6-yl]-4-(ethylamino)-4-piperidinecarboxamide
This compound is a crystalline solid with a molecular weight of approximately 533.2 g/mol. It is sparingly soluble in water but more soluble in organic solvents like DMSO and ethanol. Chemically, it is highly reactive due to the presence of chlorophenyl groups, making it susceptible to nucleophilic substitution reactions.

About

English Name 1-[8-(2-Chlorophenyl)-9-(4-chlorophenyl)-9H-purin-6-yl]-4-(ethylamino)-4-piperidinecarboxamide
Molecular Formula C25H25Cl2N7O
Molecular Weight 510.43 g/mol
SMILES CCNC1(CCN(CC1)C2=NC=NC3=C2N=C(N3C4=CC=C(C=C4)Cl)C5=CC=CC=C5Cl)C(=O)N
InChIKey UNAZAADNBYXMIV-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 1-[8-(2-Chlorophenyl)-9-(4-chlorophenyl)-9H-purin-6-yl]-4-(ethylamino)-4-piperidinecarboxamide (CAS: 686344-29-6) typically synthesized?

The compound is typically synthesized through a multi-step process involving the coupling of a purin...

Compound Q&A

What industries use 1-[8-(2-Chlorophenyl)-9-(4-chlorophenyl)-9H-purin-6-yl]-4-(ethylamino)-4-piperidinecarboxamide (CAS: 686344-29-6)?

This compound is primarily used in the pharmaceutical industry for its potential as an antiviral age...

Compound Q&A

What precautions should be taken when handling 1-[8-(2-Chlorophenyl)-9-(4-chlorophenyl)-9H-purin-6-yl]-4-(ethylamino)-4-piperidinecarboxamide (CAS: 686344-29-6)?

When handling this compound, it is essential to wear gloves, safety goggles, and protective clothing...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...