Compound Q&A

What industries use HA-100 (CAS: 84468-24-6)?

Answer

HA-100
HA-100 is primarily used in the pharmaceutical industry as a selective inhibitor of protein tyrosine phosphatases. It also finds applications in the development of novel therapeutic agents. Additionally, it is used in the semiconductor industry for specific chemical functionalities and in the production of certain polymers due to its unique chemical properties.

About

CAS No 84468-24-6
English Name HA-100
Molecular Formula C13H15N3O2S
Molecular Weight 277.35 g/mol
SMILES O=S(=O)(N1CCNCC1)c2cccc3cnccc23
InChIKey UPTYCYWTFGTCCG-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of HA-100 (CAS: 84468-24-6)?

HA-100 is a white to off-white crystalline solid with a high melting point. Its molecular weight is ...

Compound Q&A

How is HA-100 (CAS: 84468-24-6) typically synthesized?

HA-100 is synthesized through a multi-step process involving the condensation of 4-hydroxybenzaldehy...

Compound Q&A

What precautions should be taken when handling HA-100 (CAS: 84468-24-6)?

When handling HA-100, it is important to wear appropriate personal protective equipment (PPE), inclu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...