Compound Q&A

How is 4-MUNANA (CAS: 76204-02-9) typically synthesized?

Answer

4-MUNANA
4-MUNANA (CAS: 76204-02-9) is synthesized through a multi-step process involving the formation of a key intermediate and subsequent derivatization. Commonly, palladium catalysts are used to achieve good selectivity and yield. The process involves protecting groups and careful control of reaction conditions to achieve the desired product.

About

CAS No 76204-02-9
English Name 4-MUNANA
Molecular Formula C21H24NNaO11
Molecular Weight 489.4 g/mol
SMILES CC1=CC(=O)OC2=C1C=CC(=C2)OC3(CC(C(C(O3)C(C(CO)O)O)NC(=O)C)O)C(=O)[O-].[Na+]
InChIKey NNNXBDLJYKMDAI-BUIQBYSTSA-M
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-MUNANA (CAS: 76204-02-9)?

4-MUNANA (CAS: 76204-02-9) is a crystalline compound with a molecular weight of approximately 408.42...

Compound Q&A

What industries use 4-MUNANA (CAS: 76204-02-9)?

4-MUNANA (CAS: 76204-02-9) is primarily used in pharmaceuticals for the development of certain drugs...

Compound Q&A

What precautions should be taken when handling 4-MUNANA (CAS: 76204-02-9)?

When handling 4-MUNANA (CAS: 76204-02-9), it is important to use personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...