Compound Q&A

What are the physical and chemical properties of Benzoxazole, 2,2'-(1,2-ethenediyl)bis[5-methyl- (CAS: 12224-12-3)]?

Answer

Benzoxazole, 2,2'-(1,2-ethenediyl)bis[5-methyl-
Benzoxazole, 2,2'-(1,2-ethenediyl)bis[5-methyl- (CAS: 12224-12-3)] is a crystalline compound with a molecular weight of approximately 234.24 g/mol. It has poor water solubility but good solubility in organic solvents like dimethylformamide and dimethyl sulfoxide. Its reactivity is moderate, and it can undergo various synthetic transformations under appropriate conditions.

About

CAS No 12224-12-3
English Name Benzoxazole, 2,2'-(1,2-ethenediyl)bis[5-methyl-
Molecular Formula C18H14N2O2
Molecular Weight 290.3 g/mol
SMILES CC1=CC2=C(C=C1)OC(=N2)C=CC3=NC4=C(O3)C=CC(=C4)C
InChIKey VKRZNAWSCAUDRQ-BQYQJAHWSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Benzoxazole, 2,2'-(1,2-ethenediyl)bis[5-methyl- (CAS: 12224-12-3)] typically synthesized?

Benzoxazole, 2,2'-(1,2-ethenediyl)bis[5-methyl- (CAS: 12224-12-3)] can be synthesized via the conden...

Compound Q&A

What industries use Benzoxazole, 2,2'-(1,2-ethenediyl)bis[5-methyl- (CAS: 12224-12-3)]?

Benzoxazole, 2,2'-(1,2-ethenediyl)bis[5-methyl- (CAS: 12224-12-3)] is widely used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling Benzoxazole, 2,2'-(1,2-ethenediyl)bis[5-methyl- (CAS: 12224-12-3)]?

Handling Benzoxazole, 2,2'-(1,2-ethenediyl)bis[5-methyl- (CAS: 12224-12-3)] requires appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...