Compound Q&A

What precautions should be taken when handling (3-Chloro-2-methylphenyl)boronic acid (CAS: 313545-20-9)?

Answer

(3-Chloro-2-methylphenyl)boronic acid
When handling (3-Chloro-2-methylphenyl)boronic acid (CAS: 313545-20-9), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Ensure the use of a fume hood to minimize inhalation risks. In case of a spill, neutralize the spill with an appropriate base, and dispose of according to local regulations. Always refer to the safety data sheet (SDS) for detailed handling and safety information.

About

English Name (3-Chloro-2-methylphenyl)boronic acid
Molecular Formula C7H8BClO2
Molecular Weight 170.4 g/mol
SMILES B(C1=C(C(=CC=C1)Cl)C)(O)O
InChIKey BJPNVVXTUYMJPN-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Chloro-2-methylphenyl)boronic acid (CAS: 313545-20-9)?

The (3-Chloro-2-methylphenyl)boronic acid (CAS: 313545-20-9) is a solid, white crystalline powder. I...

Compound Q&A

How is (3-Chloro-2-methylphenyl)boronic acid (CAS: 313545-20-9) typically synthesized?

The synthesis of (3-Chloro-2-methylphenyl)boronic acid (CAS: 313545-20-9) typically involves the rea...

Compound Q&A

What industries use (3-Chloro-2-methylphenyl)boronic acid (CAS: 313545-20-9)?

(3-Chloro-2-methylphenyl)boronic acid (CAS: 313545-20-9) is primarily used in the pharmaceutical ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...