Compound Q&A

What are the physical and chemical properties of Ethyl 6,7,8-trifluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate (CAS: 79660-46-1)?

Answer

Ethyl 6,7,8-trifluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate
Ethyl 6,7,8-trifluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate is a crystalline solid with a molecular weight of approximately 272.18 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. This compound is reactive and can undergo various chemical transformations, such as reduction and alkylation.

About

CAS No 79660-46-1
English Name Ethyl 6,7,8-trifluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate
Molecular Formula C12H8F3NO3
Molecular Weight 271.19 g/mol
SMILES CCOC(=O)C1=CNC2=C(C(=C(C=C2C1=O)F)F)F
InChIKey ONQDAESGZUODFI-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Ethyl 6,7,8-trifluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate (CAS: 79660-46-1) typically synthesized?

Ethyl 6,7,8-trifluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate is typically synthesized via a multi-...

Compound Q&A

What industries use Ethyl 6,7,8-trifluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate (CAS: 79660-46-1)?

Ethyl 6,7,8-trifluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate finds application in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling Ethyl 6,7,8-trifluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate (CAS: 79660-46-1)?

When handling Ethyl 6,7,8-trifluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate, it is essential to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...