Compound Q&A

What are the physical and chemical properties of Abaloparatide (CAS: 247062-33-5)?

Answer

Abaloparatide
Abaloparatide is a cyclic pentapeptide with a molecular weight of approximately 760 Da. It is poorly soluble in water but soluble in acidic and basic aqueous solutions. This compound is stable under normal storage conditions but exhibits limited reactivity with reducing agents and heavy metals. Abaloparatide has a crystalline form and is typically stored at 2°C to 8°C to maintain its stability.

About

English Name Abaloparatide
Molecular Formula C174H300N56O49
Molecular Weight 3960.59 g/mol
SMILES O=C([C@H](CC(C)C)NC([C@H](CCCCN)NC([C@H](CCC(=O)O)NC([C@H](CC(C)C)NC([C@H](CC(C)C)NC([C@H](CCC(=O)O)NC([C@H](CCCNC(=N)N)NC([C@H](CCCNC(=N)N)NC([C@H](CCCNC(=N)N)NC([C@H](CC(C)C)NC([C@H](CC(=O)O)NC([C@H](CCC(N)=O)NC([C@H]([C@@H](C)CC)NC([C@H](CO)NC([C@H](CCCCN)NC(CNC([C@H](CCCCN)NC([C@H](CC(=O)O)NC([C@H](CC1=CN=CN1)NC([C@H](CC(C)C)NC([C@H](CC(C)C)NC([C@H](CCC(N)=O)NC([C@H](CC1=CN=CN1)NC([C@H](CCC(=O)O)NC([C@H](CO)NC([C@H](C(C)C)NC([C@H](C)N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)N[C@H](C(NC(C)(C)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N)=O)C)=O)[C@@H](C)O)=O)CC1=CN=CN1)=O)CC(C)C)=O)CCCCN)=O)=O)CC(C)C
InChIKey BVISQZFBLRSESR-XSCWXTNMSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Abaloparatide (CAS: 247062-33-5) typically synthesized?

Abaloparatide is synthesized via solid-phase peptide synthesis (SPPS) using Fmoc chemistry. The synt...

Compound Q&A

What industries use Abaloparatide (CAS: 247062-33-5)?

Abaloparatide is primarily used in the pharmaceutical industry for treating osteoporosis. It is also...

Compound Q&A

What precautions should be taken when handling Abaloparatide (CAS: 247062-33-5)?

When handling Abaloparatide, appropriate personal protective equipment (PPE) such as gloves and lab ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...